EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25NO8 |
| Net Charge | 0 |
| Average Mass | 455.463 |
| Monoisotopic Mass | 455.15802 |
| SMILES | C[C@H]1O[C@@H]2CC(=O)O[C@@H]2C2=C1C(=O)c1c(O)cc3c(c1C2=O)[C@H]1C[C@@H](N(C)C)[C@H](O)[C@]3(C)O1 |
| InChI | InChI=1S/C24H25NO8/c1-8-15-19(22-13(31-8)7-14(27)32-22)21(29)18-16-9(5-11(26)17(18)20(15)28)24(2)23(30)10(25(3)4)6-12(16)33-24/h5,8,10,12-13,22-23,26,30H,6-7H2,1-4H3/t8-,10-,12-,13-,22+,23+,24-/m1/s1 |
| InChIKey | JZGRDBGLULKCDD-HFJLKIIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Thermomonospora (ncbitaxon:2019) | - | PubMed (2753813) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sch 38519 (CHEBI:221783) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| (1R,6R,10R,12R,19R,20S,21R)-21-(dimethylamino)-16,20-dihydroxy-12,19-dimethyl-7,11,23-trioxahexacyclo[17.3.1.02,18.03,15.05,13.06,10]tricosa-2,5(13),15,17-tetraene-4,8,14-trione |
| Manual Xrefs | Databases |
|---|---|
| 8181433 | ChemSpider |