EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H62O10 |
| Net Charge | 0 |
| Average Mass | 654.882 |
| Monoisotopic Mass | 654.43430 |
| SMILES | CC[C@]1([C@@H]2O[C@@H]([C@H]3O[C@](C)(O)[C@H](C)C[C@@H]3C)C[C@@H]2C)CC[C@@H]([C@]2(C)CC[C@]3(C[C@H](O)[C@@H](C)[C@@H]([C@@H](C)[C@H](OC)[C@H](C)C(=O)O)O3)O2)O1 |
| InChI | InChI=1S/C36H62O10/c1-11-35(31-20(3)17-26(42-31)28-19(2)16-21(4)34(9,40)44-28)13-12-27(43-35)33(8)14-15-36(46-33)18-25(37)22(5)30(45-36)23(6)29(41-10)24(7)32(38)39/h19-31,37,40H,11-18H2,1-10H3,(H,38,39)/t19-,20-,21+,22+,23-,24-,25-,26+,27-,28-,29-,30-,31+,33-,34-,35+,36+/m0/s1 |
| InChIKey | GORGDRGXUKJXOM-OQKBIKENSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (2753815) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 26-deoxymonensin A (CHEBI:221778) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| (2S,3S,4S)-4-[(2S,5R,7S,8R,9S)-2-[(2S,5R)-5-ethyl-5-[(2R,3S,5R)-5-[(2S,3S,5R,6S)-6-hydroxy-3,5,6-trimethyloxan-2-yl]-3-methyloxolan-2-yl]oxolan-2-yl]-7-hydroxy-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-3-methoxy-2-methylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442950 | ChemSpider |