EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36N2O4 |
| Net Charge | 0 |
| Average Mass | 428.573 |
| Monoisotopic Mass | 428.26751 |
| SMILES | CCCCC(C)C(=O)N[C@@H](C(=O)N1C(=O)C(C)=C(OC)[C@@H]1Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C25H36N2O4/c1-7-8-12-17(4)23(28)26-21(16(2)3)25(30)27-20(15-19-13-10-9-11-14-19)22(31-6)18(5)24(27)29/h9-11,13-14,16-17,20-21H,7-8,12,15H2,1-6H3,(H,26,28)/t17?,20-,21+/m0/s1 |
| InChIKey | HMXDFLALTRZBII-GLTUQPQBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | DOI (10.1016/s0040-4020(02)00895-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Palauimide (CHEBI:221768) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-[(2R)-1-[(2S)-2-benzyl-3-methoxy-4-methyl-5-oxo-2H-pyrrol-1-yl]-3-methyl-1-oxobutan-2-yl]-2-methylhexanamide |
| Manual Xrefs | Databases |
|---|---|
| 9147218 | ChemSpider |