EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O5 |
| Net Charge | 0 |
| Average Mass | 340.375 |
| Monoisotopic Mass | 340.13107 |
| SMILES | COc1cccc2c1C(=O)c1ccc3c(c1[C@H]2O)[C@@H](O)C[C@@H](C)[C@@H]3O |
| InChI | InChI=1S/C20H20O5/c1-9-8-13(21)15-11(18(9)22)6-7-12-17(15)20(24)10-4-3-5-14(25-2)16(10)19(12)23/h3-7,9,13,18,20-22,24H,8H2,1-2H3/t9-,13+,18+,20+/m1/s1 |
| InChIKey | VAXYHYYWGOLRHM-VTWGAWQSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies CB02414 (ncbitaxon:1703922) | - | PubMed (34600534) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rubiginone L (CHEBI:221754) is a phenanthrol (CHEBI:25962) |