EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O6 |
| Net Charge | 0 |
| Average Mass | 356.374 |
| Monoisotopic Mass | 356.12599 |
| SMILES | COc1cccc2c1C(=O)c1ccc3c(c1[C@H]2O)[C@@H](O)[C@@H](O)[C@@H](C)[C@@H]3O |
| InChI | InChI=1S/C20H20O6/c1-8-16(21)10-6-7-11-14(15(10)20(25)17(8)22)19(24)9-4-3-5-12(26-2)13(9)18(11)23/h3-8,16-17,19-22,24-25H,1-2H3/t8-,16-,17-,19-,20+/m0/s1 |
| InChIKey | XJODQKSMDGEWCE-PVQKUAIRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies CB02414 (ncbitaxon:1703922) | - | PubMed (34600534) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rubiginone K (CHEBI:221748) is a phenanthrol (CHEBI:25962) |