EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9N3O4 |
| Net Charge | 0 |
| Average Mass | 163.133 |
| Monoisotopic Mass | 163.05931 |
| SMILES | N[C@@H](CC[N+]([O-])=NO)C(=O)O |
| InChI | InChI=1S/C4H9N3O4/c5-3(4(8)9)1-2-7(11)6-10/h3,10H,1-2,5H2,(H,8,9)/t3-/m0/s1 |
| InChIKey | RMTXCTHJOJRMCZ-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (2793592) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Homoalanosine (CHEBI:221743) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| [(3S)-3-amino-3-carboxypropyl]-hydroxyimino-oxidoazanium |
| Manual Xrefs | Databases |
|---|---|
| 78442946 | ChemSpider |