EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N2 |
| Net Charge | 0 |
| Average Mass | 266.388 |
| Monoisotopic Mass | 266.17830 |
| SMILES | c1ccc(C[C@H]2CN[C@@H](Cc3ccccc3)CN2)cc1 |
| InChI | InChI=1S/C18H22N2/c1-3-7-15(8-4-1)11-17-13-20-18(14-19-17)12-16-9-5-2-6-10-16/h1-10,17-20H,11-14H2/t17-,18-/m0/s1 |
| InChIKey | MHZXGSQZAQYQPG-ROUUACIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus hancockii (ncbitaxon:1873369) | - | PubMed (33242032) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xenocockiamide A (CHEBI:221727) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| (2S,5S)-2,5-dibenzylpiperazine |
| Manual Xrefs | Databases |
|---|---|
| 13077530 | ChemSpider |