EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24N2O6 |
| Net Charge | 0 |
| Average Mass | 316.354 |
| Monoisotopic Mass | 316.16344 |
| SMILES | COC1=C(NCCCCC(N)C(=O)O)CC(O)(CO)CC1=O |
| InChI | InChI=1S/C14H24N2O6/c1-22-12-10(6-14(21,8-17)7-11(12)18)16-5-3-2-4-9(15)13(19)20/h9,16-17,21H,2-8,15H2,1H3,(H,19,20) |
| InChIKey | LFXJZRGVICKOLP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nodulariaspeciesmigena (ncbitaxon:70799) | - | PubMed (19691450) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mycosporine-lysine (CHEBI:221718) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-6-[[5-hydroxy-5-(hydroxymethyl)-2-methoxy-3-oxocyclohexen-1-yl]amino]hexanoic acid |