EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N2O3S2 |
| Net Charge | 0 |
| Average Mass | 338.454 |
| Monoisotopic Mass | 338.07588 |
| SMILES | CN1[C@H]([C@@H]2CSC(c3ccccc3O)=N2)SC[C@]1(C)C(=O)O |
| InChI | InChI=1S/C15H18N2O3S2/c1-15(14(19)20)8-22-13(17(15)2)10-7-21-12(16-10)9-5-3-4-6-11(9)18/h3-6,10,13,18H,7-8H2,1-2H3,(H,19,20)/t10-,13-,15+/m0/s1 |
| InChIKey | IYXVCNSDGXPAND-VZJVUDMVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (2808141) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thiazostatin B (CHEBI:221714) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S,4S)-2-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]-3,4-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442942 | ChemSpider |