EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2 |
| Net Charge | 0 |
| Average Mass | 240.350 |
| Monoisotopic Mass | 240.16265 |
| SMILES | C[C@H]1C[C@@H]2c3cccc4ncc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C16H20N2/c1-10-6-13-12-4-3-5-14-16(12)11(8-17-14)7-15(13)18(2)9-10/h3-5,8,10,13,15,17H,6-7,9H2,1-2H3/t10-,13+,15+/m0/s1 |
| InChIKey | VLMZMRDOMOGGFA-PSOPSSQASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyroclavine (CHEBI:221700) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (6aR,9S,10aR)-7,9-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-g]quinoline |
| Manual Xrefs | Databases |
|---|---|
| 2340761 | ChemSpider |