EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O6 |
| Net Charge | 0 |
| Average Mass | 486.649 |
| Monoisotopic Mass | 486.29814 |
| SMILES | CC(=O)OC(CC=C(C)C)C[C@@]1(C)CCC[C@H]2[C@@]3(C)C=CC(=O)[C@@H](C)[C@@H]3[C@H](OC(C)=O)C(=O)[C@@]21C |
| InChI | InChI=1S/C29H42O6/c1-17(2)11-12-21(34-19(4)30)16-27(6)14-9-10-23-28(7)15-13-22(32)18(3)24(28)25(35-20(5)31)26(33)29(23,27)8/h11,13,15,18,21,23-25H,9-10,12,14,16H2,1-8H3/t18-,21?,23+,24-,25+,27-,28-,29-/m1/s1 |
| InChIKey | GSGLWPRVSBCOJV-AZQYEMCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (25594349) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,8,10,14-tetramethyl-6-acetoxy-14-[16-acetoxy-19-(20,21-dimethyl)-18-ene]phenanthrene-1-ene-3,7-dione (CHEBI:221685) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| [(1R,4aS,4bR,8S,8aS,9S,10aS)-1-(2-acetyloxy-5-methylhex-4-enyl)-1,4b,8,10a-tetramethyl-7,10-dioxo-3,4,4a,8,8a,9-hexahydro-2H-phenanthren-9-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 34451994 | ChemSpider |