EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O6 |
| Net Charge | 0 |
| Average Mass | 260.286 |
| Monoisotopic Mass | 260.12599 |
| SMILES | C[C@H]1C(=O)O[C@@](C)(C2O[C@](C)(O)[C@H](O)[C@H]2C)[C@H]1O |
| InChI | InChI=1S/C12H20O6/c1-5-8(14)12(4,16)17-9(5)11(3)7(13)6(2)10(15)18-11/h5-9,13-14,16H,1-4H3/t5-,6-,7+,8-,9?,11-,12+/m1/s1 |
| InChIKey | AVAWQJCEESYVCC-SQLZSLSKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botrytis cinerea B05.10 (ncbitaxon:332648) | - | PubMed (33429353) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cinbotolide D (CHEBI:221678) is a 3-hydroxy carboxylic acid (CHEBI:61355) |