EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N4O9 |
| Net Charge | 0 |
| Average Mass | 450.404 |
| Monoisotopic Mass | 450.13868 |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](C(=O)O)[C@H]1O[C@@H](n2cc(C=O)nc2=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H22N4O9/c20-11(5-8-1-3-10(25)4-2-8)16(28)22-12(18(29)30)15-13(26)14(27)17(32-15)23-6-9(7-24)21-19(23)31/h1-4,6-7,11-15,17,25-27H,5,20H2,(H,21,31)(H,22,28)(H,29,30)/t11-,12+,13+,14+,15+,17+/m0/s1 |
| InChIKey | AEDRUJHNHSLWIZ-WTUOYXTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (2137814) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nikkomycin WX (CHEBI:221677) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-2-[(2R,3R,4R,5R)-5-(5-ormyl-2-oxo-1H-imidazol-3-yl)-3,4-dihydroxyoxolan-2-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442937 | ChemSpider |