EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O4 |
| Net Charge | 0 |
| Average Mass | 316.397 |
| Monoisotopic Mass | 316.16746 |
| SMILES | C=CC1(C)CCC2=C(C1)C(=O)CC1C(CO)=CC(=O)C(O)C21C |
| InChI | InChI=1S/C19H24O4/c1-4-18(2)6-5-13-12(9-18)15(21)8-14-11(10-20)7-16(22)17(23)19(13,14)3/h4,7,14,17,20,23H,1,5-6,8-10H2,2-3H3 |
| InChIKey | NFZRXQHLYHVCAL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomaduraspecies SpB081030SC-15 (ncbitaxon:745696) | - | PubMed (20551988) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JBIR-65 (CHEBI:221642) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 7-ethenyl-4-hydroxy-1-(hydroxymethyl)-4a,7-dimethyl-4,5,6,8,10,10a-hexahydrophenanthrene-3,9-dione |
| Manual Xrefs | Databases |
|---|---|
| 27024947 | ChemSpider |