EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H44O5 |
| Net Charge | 0 |
| Average Mass | 496.688 |
| Monoisotopic Mass | 496.31887 |
| SMILES | CC1=C(C)C2(C[C@@H](C)[C@H]3[C@@H](C[C@@]4(C)C5=C(CC[C@]34C)[C@@]3(C)CC[C@@H](O)[C@@](C)(C=O)C3CC5)O2)OC1=O |
| InChI | InChI=1S/C31H44O5/c1-17-14-31(19(3)18(2)26(34)36-31)35-22-15-30(7)21-8-9-23-27(4,12-11-24(33)28(23,5)16-32)20(21)10-13-29(30,6)25(17)22/h16-17,22-25,33H,8-15H2,1-7H3/t17-,22-,23?,24-,25+,27-,28+,29-,30+,31?/m1/s1 |
| InChIKey | AIIFPMZCMGTNMA-BBQUROITSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hexagonia apiaria (ncbitaxon:252826) | - | PubMed (26575215) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hexagonin D (CHEBI:221640) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (2R,4R,8R,9R,10R,14S,17R,18S)-17-hydroxy-2,3',4',8,10,14,18-heptamethyl-5'-oxospiro[5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicos-1(13)-ene-6,2'-uran]-18-carbaldehyde |
| Manual Xrefs | Databases |
|---|---|
| 78441397 | ChemSpider |