EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O3 |
| Net Charge | 0 |
| Average Mass | 208.257 |
| Monoisotopic Mass | 208.10994 |
| SMILES | C/C=C/[C@@H](O)C/C=C/C=C/C=C\C(=O)O |
| InChI | InChI=1S/C12H16O3/c1-2-8-11(13)9-6-4-3-5-7-10-12(14)15/h2-8,10-11,13H,9H2,1H3,(H,14,15)/b5-3+,6-4+,8-2+,10-7-/t11-/m1/s1 |
| InChIKey | SBABGWPTFUGDSU-KQQMMECGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus nidulans (ncbitaxon:162425) | - | PubMed (33991663) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BAA (CHEBI:221624) is a hydroxy fatty acid (CHEBI:24654) |