EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23N3O2 |
| Net Charge | 0 |
| Average Mass | 325.412 |
| Monoisotopic Mass | 325.17903 |
| SMILES | C[C@@H](CO)NC(=O)[C@H]1C=C2c3cccc4ncc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C19H23N3O2/c1-11(10-23)21-19(24)13-6-15-14-4-3-5-16-18(14)12(8-20-16)7-17(15)22(2)9-13/h3-6,8,11,13,17,20,23H,7,9-10H2,1-2H3,(H,21,24)/t11-,13-,17+/m0/s1 |
| InChIKey | WVVSZNPYNCNODU-PLQHRBFRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Claviceps purpurea (ncbitaxon:5111) | - | PubMed (21588630) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ergometrinine (CHEBI:221611) is a ergoline alkaloid (CHEBI:60529) |
| IUPAC Name |
|---|
| (6aR,9S)-N-[(2S)-1-hydroxypropan-2-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-g]quinoline-9-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 4588887 | ChemSpider |