EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H43N3O7S |
| Net Charge | 0 |
| Average Mass | 541.711 |
| Monoisotopic Mass | 541.28217 |
| SMILES | CCCCCCC[C@H](N)[C@H](O)C(=O)N(C)[C@@H](CCS(C)=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)OC |
| InChI | InChI=1S/C26H43N3O7S/c1-5-6-7-8-9-10-20(27)23(31)25(33)29(2)22(15-16-37(4)35)24(32)28-21(26(34)36-3)17-18-11-13-19(30)14-12-18/h11-14,20-23,30-31H,5-10,15-17,27H2,1-4H3,(H,28,32)/t20-,21-,22-,23-,37?/m0/s1 |
| InChIKey | LMUKNGXVZWJANM-DHWRZQMWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis (ncbitaxon:1125) | - | PubMed (29405714) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin 527 methyl ester (CHEBI:221598) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl (2S)-2-[[(2S)-2-[[(2S,3S)-3-amino-2-hydroxydecanoyl]-methylamino]-4-methylsulinylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoate |