EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40N6O7 |
| Net Charge | 0 |
| Average Mass | 596.685 |
| Monoisotopic Mass | 596.29585 |
| SMILES | N=C(N)N1CCC[C@H](NC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2ccc(O)cc2)NC(=O)C(O)CCc2ccc(O)cc2)C1O |
| InChI | InChI=1S/C30H40N6O7/c31-30(32)36-16-1-3-22(28(36)42)33-26(40)24-4-2-15-35(24)29(43)23(17-19-7-12-21(38)13-8-19)34-27(41)25(39)14-9-18-5-10-20(37)11-6-18/h5-8,10-13,22-25,28,37-39,42H,1-4,9,14-17H2,(H3,31,32)(H,33,40)(H,34,41)/t22-,23+,24-,25?,28?/m0/s1 |
| InChIKey | QXBUDVOMMRXMPC-TUSVKCCSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sphaerospermopsis torques-reginae ITEP-024 (ncbitaxon:984208) | - | PubMed (28876933) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spumigin N (CHEBI:221593) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S)-N-[(3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]-1-[(2R)-2-[[2-hydroxy-4-(4-hydroxyphenyl)butanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carboxamide |