EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42N6O6 |
| Net Charge | 0 |
| Average Mass | 582.702 |
| Monoisotopic Mass | 582.31658 |
| SMILES | CC1CC(C(=O)NCCCCN=C(N)N)N(C(=O)[C@H](CCc2ccc(O)cc2)NC(=O)[C@H](O)Cc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C30H42N6O6/c1-19-16-25(27(40)33-14-2-3-15-34-30(31)32)36(18-19)29(42)24(13-8-20-4-9-22(37)10-5-20)35-28(41)26(39)17-21-6-11-23(38)12-7-21/h4-7,9-12,19,24-26,37-39H,2-3,8,13-18H2,1H3,(H,33,40)(H,35,41)(H4,31,32,34)/t19?,24-,25?,26+/m0/s1 |
| InChIKey | NLJRMAAFNUDGBC-LMOYGDGSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nodulariaspeciesmigena (ncbitaxon:70799) | - | PubMed (27834904) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spumigin 582b (CHEBI:221548) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-[4-(diaminomethylideneamino)butyl]-1-[(2S)-2-[[(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]-4-methylpyrrolidine-2-carboxamide |