EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H42N6O9 |
| Net Charge | 0 |
| Average Mass | 654.721 |
| Monoisotopic Mass | 654.30133 |
| SMILES | CC(=O)OC(Cc1ccc(O)cc1)C(=O)NC(CCc1ccc(O)cc1)C(=O)N1CCCC1C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C32H42N6O9/c1-19(39)47-27(18-21-8-13-23(41)14-9-21)29(43)36-24(15-10-20-6-11-22(40)12-7-20)30(44)38-17-3-5-26(38)28(42)37-25(31(45)46)4-2-16-35-32(33)34/h6-9,11-14,24-27,40-41H,2-5,10,15-18H2,1H3,(H,36,43)(H,37,42)(H,45,46)(H4,33,34,35) |
| InChIKey | PAHUSUOEHURDBG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nodulariaspeciesmigena (ncbitaxon:70799) | - | PubMed (27834904) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spumigin 654 (CHEBI:221536) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[[1-[2-[[2-acetyloxy-3-(4-hydroxyphenyl)propanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |