EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H44N6O8 |
| Net Charge | 0 |
| Average Mass | 652.749 |
| Monoisotopic Mass | 652.32206 |
| SMILES | CC(=O)OC(Cc1ccc(O)cc1)C(=O)NC(CCc1ccc(O)cc1)C(=O)N1C[C@@H](C)CC1C(=O)NC(C=O)CCCN=C(N)N |
| InChI | InChI=1S/C33H44N6O8/c1-20-16-28(30(44)37-24(19-40)4-3-15-36-33(34)35)39(18-20)32(46)27(14-9-22-5-10-25(42)11-6-22)38-31(45)29(47-21(2)41)17-23-7-12-26(43)13-8-23/h5-8,10-13,19-20,24,27-29,42-43H,3-4,9,14-18H2,1-2H3,(H,37,44)(H,38,45)(H4,34,35,36)/t20-,24?,27?,28?,29?/m0/s1 |
| InChIKey | RGNYKGKCLHZFNV-RUKLUMRPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nodulariaspeciesmigena (ncbitaxon:70799) | - | PubMed (27834904) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spumigin 652 (CHEBI:221523) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [1-[[1-[(4S)-2-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-4-methylpyrrolidin-1-yl]-4-(4-hydroxyphenyl)-1-oxobutan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl] acetate |