EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H48ClN3O8 |
| Net Charge | 0 |
| Average Mass | 722.279 |
| Monoisotopic Mass | 721.31299 |
| SMILES | CCC/C=C\c1ccccc1CCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N(C)[C@@H](Cc1ccc(OC)c(O)c1Cl)C(=O)N(C)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C39H48ClN3O8/c1-7-8-9-12-27-13-10-11-14-28(27)18-22-34(45)41-31(23-26-15-19-30(44)20-16-26)37(47)43(4)32(38(48)42(3)25(2)39(49)51-6)24-29-17-21-33(50-5)36(46)35(29)40/h9-17,19-21,25,31-32,44,46H,7-8,18,22-24H2,1-6H3,(H,41,45)/b12-9-/t25-,31-,32-/m0/s1 |
| InChIKey | SYPITNCLZUCKPU-JMJZKUPFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies PKU-MA01144 (ncbitaxon:2729138) | - | PubMed (32489098) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pepticinnamin I (CHEBI:221514) is a peptide (CHEBI:16670) |