EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H52ClN5O10 |
| Net Charge | 0 |
| Average Mass | 834.367 |
| Monoisotopic Mass | 833.34027 |
| SMILES | CCC/C=C\c1ccccc1CCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N(C)[C@@H](Cc1ccc(OC)c(O)c1Cl)C(=O)N(C)[C@@H](C)C(=O)OC[C@H]1NC(=O)CNC1=O |
| InChI | InChI=1S/C43H52ClN5O10/c1-6-7-8-11-28-12-9-10-13-29(28)17-21-36(51)46-32(22-27-14-18-31(50)19-15-27)41(55)49(4)34(23-30-16-20-35(58-5)39(53)38(30)44)42(56)48(3)26(2)43(57)59-25-33-40(54)45-24-37(52)47-33/h8-16,18-20,26,32-34,50,53H,6-7,17,21-25H2,1-5H3,(H,45,54)(H,46,51)(H,47,52)/b11-8-/t26-,32-,33+,34-/m0/s1 |
| InChIKey | GXICVNHVUHOCTR-CCXTWYSHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies PKU-MA01144 (ncbitaxon:2729138) | - | PubMed (32489098) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pepticinnamin G (CHEBI:221505) is a depsipeptide (CHEBI:23643) |