EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H51N5O6 |
| Net Charge | 0 |
| Average Mass | 625.811 |
| Monoisotopic Mass | 625.38393 |
| SMILES | CCC(C)[C@@H]1NC(=O)[C@H](Cc2cn(OC)c3ccccc23)NC(=O)[C@H](CCCCC[C@@H](O)CC)NC(=O)[C@H]2CCCCN2C1=O |
| InChI | InChI=1S/C34H51N5O6/c1-5-22(3)30-34(44)38-19-13-12-18-29(38)33(43)35-26(16-9-7-8-14-24(40)6-2)31(41)36-27(32(42)37-30)20-23-21-39(45-4)28-17-11-10-15-25(23)28/h10-11,15,17,21-22,24,26-27,29-30,40H,5-9,12-14,16,18-20H2,1-4H3,(H,35,43)(H,36,41)(H,37,42)/t22?,24-,26-,27-,29+,30-/m0/s1 |
| InChIKey | XSKZVBPNWYDMNT-YWHDRAQFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusariumspecies (ncbitaxon:29916) | - | PubMed (11856024) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apicidin D2 (CHEBI:221497) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (3S,6S,9S,12R)-3-butan-2-yl-9-[(6S)-6-hydroxyoctyl]-6-[(1-methoxyindol-3-yl)methyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 9192781 | ChemSpider |