EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H49N9O6 |
| Net Charge | 0 |
| Average Mass | 751.889 |
| Monoisotopic Mass | 751.38058 |
| SMILES | CC(C)[C@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CCCN(O)C(=N)N)NC(=O)[C@H](Cc2cnc3ccccc23)NC1=O |
| InChI | InChI=1S/C40H49N9O6/c1-24(2)34-39(54)47-33(22-27-23-43-29-17-10-9-16-28(27)29)37(52)44-30(18-11-19-49(55)40(41)42)35(50)45-31(20-25-12-5-3-6-13-25)36(51)46-32(38(53)48-34)21-26-14-7-4-8-15-26/h3-10,12-17,23-24,30-34,43,55H,11,18-22H2,1-2H3,(H3,41,42)(H,44,52)(H,45,50)(H,46,51)(H,47,54)(H,48,53)/t30-,31+,32-,33-,34+/m0/s1 |
| InChIKey | YXRGKAXXJOEWHW-QLAJLQEUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (32927831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pentaminomycin E (CHEBI:221480) is a oligopeptide (CHEBI:25676) |