EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H49N9O6 |
| Net Charge | 0 |
| Average Mass | 703.845 |
| Monoisotopic Mass | 703.38058 |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CCCN(O)C(=N)N)NC(=O)[C@H](Cc2cnc3ccccc23)NC(=O)[C@@H](C(C)C)NC1=O |
| InChI | InChI=1S/C36H49N9O6/c1-20(2)29-34(49)42-28(18-23-19-39-25-14-9-8-13-24(23)25)32(47)40-26(15-10-16-45(51)36(37)38)31(46)41-27(17-22-11-6-5-7-12-22)33(48)43-30(21(3)4)35(50)44-29/h5-9,11-14,19-21,26-30,39,51H,10,15-18H2,1-4H3,(H3,37,38)(H,40,47)(H,41,46)(H,42,49)(H,43,48)(H,44,50)/t26-,27+,28-,29+,30-/m0/s1 |
| InChIKey | KCWUMMUIGCKNGQ-PCPRHZMTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (32927831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pentaminomycin D (CHEBI:221479) is a oligopeptide (CHEBI:25676) |