EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6N2O4 |
| Net Charge | 0 |
| Average Mass | 158.113 |
| Monoisotopic Mass | 158.03276 |
| SMILES | N[C@@H](C(=O)O)c1cnc(=O)o1 |
| InChI | InChI=1S/C5H6N2O4/c6-3(4(8)9)2-1-7-5(10)11-2/h1,3H,6H2,(H,7,10)(H,8,9)/t3-/m1/s1 |
| InChIKey | ASBGWPLVVIASBE-GSVOUGTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amanita muscaria (ncbitaxon:41956) | - | PubMed (14321964) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Muscazone (CHEBI:221476) is a D-α-amino acid (CHEBI:16733) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-2-(2-oxo-3H-1,3-oxazol-5-yl)acetate |
| Manual Xrefs | Databases |
|---|---|
| 16735919 | ChemSpider |