EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H11NO5 |
| Net Charge | 0 |
| Average Mass | 321.288 |
| Monoisotopic Mass | 321.06372 |
| SMILES | N=C1c2cc(C=O)cc(O)c2-c2c1c(O)c1c(O)cccc1c2O |
| InChI | InChI=1S/C18H11NO5/c19-16-9-4-7(6-20)5-11(22)12(9)14-15(16)18(24)13-8(17(14)23)2-1-3-10(13)21/h1-6,19,21-24H |
| InChIKey | DOQMQJQSESKCPL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces viridochromogenes (ncbitaxon:1938) | - | DOI (10.1016/s0040-4039(00)60923-1) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stealthin B (CHEBI:221475) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| 4,5,9,10-tetrahydroxy-11-iminobenzo[b]luorene-2-carbaldehyde |
| Manual Xrefs | Databases |
|---|---|
| 78434905 | ChemSpider |