EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31NO4 |
| Net Charge | 0 |
| Average Mass | 373.493 |
| Monoisotopic Mass | 373.22531 |
| SMILES | CCCCCCCCC/C=C/C(=O)N/C(=C/c1ccc(O)c(C)c1)C(=O)O |
| InChI | InChI=1S/C22H31NO4/c1-3-4-5-6-7-8-9-10-11-12-21(25)23-19(22(26)27)16-18-13-14-20(24)17(2)15-18/h11-16,24H,3-10H2,1-2H3,(H,23,25)(H,26,27)/b12-11+,19-16+ |
| InChIKey | DDNDRMDMCPLBPG-NXOKQZBISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stieleria (ncbitaxon:2795973) | - | PubMed (32533057) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stieleriacine A2 (CHEBI:221451) is a N-acyl-amino acid (CHEBI:51569) |