EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30N8O6 |
| Net Charge | 0 |
| Average Mass | 478.510 |
| Monoisotopic Mass | 478.22883 |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CC[C@H](N)C=C1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C20H30N8O6/c1-8(2)12(20(32)33)27-18(31)10(22)4-3-9(21)5-11-14(29)15(30)19(34-11)28-7-26-13-16(23)24-6-25-17(13)28/h5-10,12,14-15,19,29-30H,3-4,21-22H2,1-2H3,(H,27,31)(H,32,33)(H2,23,24,25)/t9-,10-,12-,14+,15+,19+/m0/s1 |
| InChIKey | UDECQDDIZRDHFH-FSMGVUPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (20859291) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dehydrosinefungin V (CHEBI:221429) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S,5S)-2,5-diamino-6-[(3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-ylidene]hexanoyl]amino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438220 | ChemSpider |