EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H56N8O8 |
| Net Charge | 0 |
| Average Mass | 788.947 |
| Monoisotopic Mass | 788.42211 |
| SMILES | CC(C)[C@H](NC(=O)N[C@@H]1CCCCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](C)N(C)C(=O)[C@@H](Cc2cnc3ccccc23)NC(=O)[C@@H](C(C)C)NC1=O)C(=O)O |
| InChI | InChI=1S/C41H56N8O8/c1-23(2)33-38(53)45-32(21-27-22-43-29-17-11-10-16-28(27)29)39(54)49(6)25(5)35(50)44-31(20-26-14-8-7-9-15-26)36(51)42-19-13-12-18-30(37(52)47-33)46-41(57)48-34(24(3)4)40(55)56/h7-11,14-17,22-25,30-34,43H,12-13,18-21H2,1-6H3,(H,42,51)(H,44,50)(H,45,53)(H,47,52)(H,55,56)(H2,46,48,57)/t25-,30-,31-,32-,33-,34+/m1/s1 |
| InChIKey | HEAKELJCVBVEKW-LBEIPMMNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brasilonemaspecies CT11 (ncbitaxon:2748322) | - | PubMed (32825321) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anabaenopeptin 788 (CHEBI:221412) is a oligopeptide (CHEBI:25676) |