EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31N5O12 |
| Net Charge | 0 |
| Average Mass | 569.524 |
| Monoisotopic Mass | 569.19692 |
| SMILES | C[C@@H]1CCC[C@H](NC(=O)C2=C[C@H](O)[C@H](O)[C@@H](O[C@@H](C(N)=O)[C@H]3O[C@@H](n4ccc(=O)nc4=O)[C@H](O)[C@@H]3O)O2)C(=O)N1 |
| InChI | InChI=1S/C23H31N5O12/c1-8-3-2-4-9(19(35)25-8)26-20(36)11-7-10(29)13(31)22(38-11)40-17(18(24)34)16-14(32)15(33)21(39-16)28-6-5-12(30)27-23(28)37/h5-10,13-17,21-22,29,31-33H,2-4H2,1H3,(H2,24,34)(H,25,35)(H,26,36)(H,27,30,37)/t8-,9+,10+,13+,14+,15-,16+,17-,21-,22-/m1/s1 |
| InChIKey | BFXPEJKKPCBJOT-PQXOLBNDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (12760680) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| A-500359 C (CHEBI:221407) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S,3S,4S)-2-[(1R)-2-amino-1-[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-oxoethoxy]-3,4-dihydroxy-N-[(3S,7R)-7-methyl-2-oxoazepan-3-yl]-3,4-dihydro-2H-pyran-6-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 8432898 | ChemSpider |