EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO5 |
| Net Charge | 0 |
| Average Mass | 253.254 |
| Monoisotopic Mass | 253.09502 |
| SMILES | COC(=O)c1ccc([C@H](O)[C@H](C)OC(C)=O)cn1 |
| InChI | InChI=1S/C12H15NO5/c1-7(18-8(2)14)11(15)9-4-5-10(13-6-9)12(16)17-3/h4-7,11,15H,1-3H3/t7-,11+/m0/s1 |
| InChIKey | CTJGPKROOIGCCC-WRWORJQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marasmiellus (ncbitaxon:71896) | - | PubMed (11714225) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CJ-14,897 (CHEBI:221388) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| IUPAC Name |
|---|
| methyl 5-[(1S,2S)-2-acetyloxy-1-hydroxypropyl]pyridine-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 8374425 | ChemSpider |