EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H47N5O7 |
| Net Charge | 0 |
| Average Mass | 541.690 |
| Monoisotopic Mass | 541.34755 |
| SMILES | CC[C@H](N)C(=O)C(=O)N[C@H](CC(C)C)C(=O)N(C(=O)[C@@H](N)C(C)CC(=O)[C@@H](N)C(C)C)[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C26H47N5O7/c1-9-16(27)22(33)23(34)30-17(10-12(2)3)24(35)31(21(14(6)7)26(37)38)25(36)20(29)15(8)11-18(32)19(28)13(4)5/h12-17,19-21H,9-11,27-29H2,1-8H3,(H,30,34)(H,37,38)/t15?,16-,17+,19-,20-,21-/m0/s1 |
| InChIKey | UNPBSZUDTFBULK-CZCKBYKRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (1938618) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Poststatin (CHEBI:221382) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-[[(2R)-2-[[(3S)-3-amino-2-oxopentanoyl]amino]-4-methylpentanoyl]-[(2S,6S)-2,6-diamino-3,7-dimethyl-5-oxooctanoyl]amino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 144117 | ChemSpider |