EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H21N3O9S2 |
| Net Charge | 0 |
| Average Mass | 583.600 |
| Monoisotopic Mass | 583.07192 |
| SMILES | O=c1c(Cc2ccc(OS(=O)(=O)O)cc2)nc2c(Cc3ccccc3)nc(-c3ccc(OS(=O)(=O)O)cc3)cn1-2 |
| InChI | InChI=1S/C26H21N3O9S2/c30-26-23(15-18-6-10-20(11-7-18)37-39(31,32)33)28-25-22(14-17-4-2-1-3-5-17)27-24(16-29(25)26)19-8-12-21(13-9-19)38-40(34,35)36/h1-13,16,27H,14-15H2,(H,31,32,33)(H,34,35,36) |
| InChIKey | PTGHKNQEZNRQKY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. |
| Biological Role: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Watasenia luciferin (CHEBI:17675) has functional parent Oplophorus luciferin (CHEBI:2311) |
| Watasenia luciferin (CHEBI:17675) has parent hydride imidazo[1,2-a]pyrazine (CHEBI:37846) |
| Watasenia luciferin (CHEBI:17675) has role luciferin (CHEBI:25078) |
| Watasenia luciferin (CHEBI:17675) is a aryl sulfate (CHEBI:37919) |
| Watasenia luciferin (CHEBI:17675) is a imidazopyrazine (CHEBI:37847) |
| Watasenia luciferin (CHEBI:17675) is conjugate acid of Watasenia luciferin(2−) (CHEBI:58229) |
| Incoming Relation(s) |
| Watasenia luciferin(2−) (CHEBI:58229) is conjugate base of Watasenia luciferin (CHEBI:17675) |
| IUPAC Name |
|---|
| 4-{8-benzyl-3-oxo-2-[4-(sulfooxy)benzyl]-3,7-dihydroimidazo[1,2-a]pyrazin-6-yl}phenyl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| Watasenia luciferin | KEGG COMPOUND |
| 8-(phenylmethyl)-6-(4-sulfooxyphenyl)-2-[(4-sulfooxyphenyl)methyl]imidazo[1,2-a]-pyrazin-3(7H)-one | IUBMB |
| watasemiluciferin | ChEBI |