EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H37N9O7 |
| Net Charge | 0 |
| Average Mass | 551.605 |
| Monoisotopic Mass | 551.28159 |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CC[C@H](N)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C23H37N9O7/c1-9(2)14(21(36)30-10(3)23(37)38)31-20(35)12(25)5-4-11(24)6-13-16(33)17(34)22(39-13)32-8-29-15-18(26)27-7-28-19(15)32/h7-14,16-17,22,33-34H,4-6,24-25H2,1-3H3,(H,30,36)(H,31,35)(H,37,38)(H2,26,27,28)/t10-,11-,12-,13+,14-,16+,17+,22+/m0/s1 |
| InChIKey | DOCMEZCWRQEKOV-TUUIAVOASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (20859291) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sinefungin VA (CHEBI:221344) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S,5S)-2,5-diamino-6-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]hexanoyl]amino]-3-methylbutanoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78437679 | ChemSpider |