EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32ClN5O7 |
| Net Charge | 0 |
| Average Mass | 538.001 |
| Monoisotopic Mass | 537.19903 |
| SMILES | CC[C@@H]1NC(=O)[C@@H]2[C@H](Cl)CCN2C(=O)[C@H](CO)NC(=O)C[C@H](c2ccccc2)NC(=O)[C@H](CO)NC1=O |
| InChI | InChI=1S/C24H32ClN5O7/c1-2-15-21(34)29-17(11-31)22(35)28-16(13-6-4-3-5-7-13)10-19(33)26-18(12-32)24(37)30-9-8-14(25)20(30)23(36)27-15/h3-7,14-18,20,31-32H,2,8-12H2,1H3,(H,26,33)(H,27,36)(H,28,35)(H,29,34)/t14-,15+,16-,17+,18+,20+/m1/s1 |
| InChIKey | TWLLLEZBOHPXTA-GZKCFLEVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces islandicus (ncbitaxon:28573) | - | PubMed (26954535) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclochlorotine B (CHEBI:221247) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3S,7R,10S,13S,16R,17R)-17-chloro-13-ethyl-3,10-bis(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone |