EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33N5O7 |
| Net Charge | 0 |
| Average Mass | 503.556 |
| Monoisotopic Mass | 503.23800 |
| SMILES | CC[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@H](CO)NC(=O)C[C@H](c2ccccc2)NC(=O)[C@H](CO)NC1=O |
| InChI | InChI=1S/C24H33N5O7/c1-2-15-21(33)28-17(12-30)22(34)27-16(14-7-4-3-5-8-14)11-20(32)25-18(13-31)24(36)29-10-6-9-19(29)23(35)26-15/h3-5,7-8,15-19,30-31H,2,6,9-13H2,1H3,(H,25,32)(H,26,35)(H,27,34)(H,28,33)/t15-,16+,17-,18-,19-/m0/s1 |
| InChIKey | JAPQCCQLPMCXRC-PJVZLEMVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces islandicus (ncbitaxon:28573) | - | PubMed (26954535) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclotine (CHEBI:221242) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3S,7R,10S,13S,16S)-13-ethyl-3,10-bis(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone |