EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H37ClN8O11 |
| Net Charge | 0 |
| Average Mass | 649.058 |
| Monoisotopic Mass | 648.22703 |
| SMILES | C[C@H](NC(=O)[C@H]1[C@@H](O)[C@@H](O)C=NN1C(=O)CO)C(=O)N1NC[C@@H](Cl)C[C@@H]1C(=O)N1NCCC[C@H]1C(=O)N[C@@](C)(CO)C(=O)O |
| InChI | InChI=1S/C24H37ClN8O11/c1-11(29-20(40)17-18(38)15(36)8-28-33(17)16(37)9-34)21(41)32-14(6-12(25)7-27-32)22(42)31-13(4-3-5-26-31)19(39)30-24(2,10-35)23(43)44/h8,11-15,17-18,26-27,34-36,38H,3-7,9-10H2,1-2H3,(H,29,40)(H,30,39)(H,43,44)/t11-,12-,13-,14+,15-,17+,18-,24-/m0/s1 |
| InChIKey | MDRCUWLNUYOITI-BVYJMRFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (34180937) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Svetamycin H (CHEBI:221233) is a peptide (CHEBI:16670) |