EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36N8O10 |
| Net Charge | 0 |
| Average Mass | 596.598 |
| Monoisotopic Mass | 596.25544 |
| SMILES | C[C@@H]1NC(=O)[C@H]2[C@@H](O)[C@@H](O)C=NN2C(=O)COC(=O)[C@](C)(CO)NC(=O)[C@@H]2CCCNN2C(=O)[C@H]2CCCNN2C1=O |
| InChI | InChI=1S/C24H36N8O10/c1-12-21(39)31-14(6-4-8-26-31)22(40)30-13(5-3-7-25-30)19(37)29-24(2,11-33)23(41)42-10-16(35)32-17(20(38)28-12)18(36)15(34)9-27-32/h9,12-15,17-18,25-26,33-34,36H,3-8,10-11H2,1-2H3,(H,28,38)(H,29,37)/t12-,13-,14+,15-,17+,18-,24-/m0/s1 |
| InChIKey | RZFVLHLWBNGSMA-VRJBUVLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (34180937) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Deschlorosvetamycin A (CHEBI:221230) is a cyclodepsipeptide (CHEBI:35213) |