EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H55N9O13 |
| Net Charge | 0 |
| Average Mass | 809.875 |
| Monoisotopic Mass | 809.39193 |
| SMILES | CC(=O)N(O)CCC[C@H](NC(=O)[C@H](CCCN)NC(=O)[C@H](CCCNO)N(C)C(=O)[C@H](NC(=O)CCNC(=O)[C@@H]1COC(c2ccccc2O)=N1)[C@@H](C)O)C(=O)O |
| InChI | InChI=1S/C35H55N9O13/c1-20(45)29(42-28(48)14-17-37-30(49)25-19-57-33(41-25)22-9-4-5-13-27(22)47)34(52)43(3)26(12-7-16-38-55)32(51)39-23(10-6-15-36)31(50)40-24(35(53)54)11-8-18-44(56)21(2)46/h4-5,9,13,20,23-26,29,38,45,47,55-56H,6-8,10-12,14-19,36H2,1-3H3,(H,37,49)(H,39,51)(H,40,50)(H,42,48)(H,53,54)/t20-,23+,24+,25+,26+,29-/m1/s1 |
| InChIKey | LECQGLMXQFRCBO-RGHMRBNJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parafrankiaspecies CH37 (ncbitaxon:683308) | - | PubMed (33789052) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Frankobactin C1 (CHEBI:221217) is a peptide (CHEBI:16670) |