EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H49N9O12 |
| Net Charge | 0 |
| Average Mass | 763.806 |
| Monoisotopic Mass | 763.35007 |
| SMILES | C[C@H]1OC(=O)[C@H](CCCN(O)C=O)NC(=O)[C@H](CCCN)NC(=O)[C@H](CCCNO)N(C)C(=O)[C@@H]1NC(=O)CNC(=O)[C@@H]1COC(c2ccccc2O)=N1 |
| InChI | InChI=1S/C33H49N9O12/c1-19-27(40-26(45)16-35-28(46)23-17-53-31(39-23)20-8-3-4-12-25(20)44)32(49)41(2)24(11-6-14-36-51)30(48)37-21(9-5-13-34)29(47)38-22(33(50)54-19)10-7-15-42(52)18-43/h3-4,8,12,18-19,21-24,27,36,44,51-52H,5-7,9-11,13-17,34H2,1-2H3,(H,35,46)(H,37,48)(H,38,47)(H,40,45)/t19-,21+,22+,23+,24+,27-/m1/s1 |
| InChIKey | PUSWLFCHWVKWQE-OUBBJWQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parafrankiaspecies CH37 (ncbitaxon:683308) | - | PubMed (33789052) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Frankobactin B2 (CHEBI:221209) is a cyclodepsipeptide (CHEBI:35213) |