EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H51N9O12 |
| Net Charge | 0 |
| Average Mass | 777.833 |
| Monoisotopic Mass | 777.36572 |
| SMILES | C[C@H]1OC(=O)[C@H](CCCN(O)C=O)NC(=O)[C@H](CCCN)NC(=O)[C@H](CCCNO)N(C)C(=O)[C@@H]1NC(=O)CCNC(=O)[C@@H]1COC(c2ccccc2O)=N1 |
| InChI | InChI=1S/C34H51N9O12/c1-20-28(41-27(46)13-16-36-29(47)24-18-54-32(40-24)21-8-3-4-12-26(21)45)33(50)42(2)25(11-6-15-37-52)31(49)38-22(9-5-14-35)30(48)39-23(34(51)55-20)10-7-17-43(53)19-44/h3-4,8,12,19-20,22-25,28,37,45,52-53H,5-7,9-11,13-18,35H2,1-2H3,(H,36,47)(H,38,49)(H,39,48)(H,41,46)/t20-,22+,23+,24+,25+,28-/m1/s1 |
| InChIKey | IBPQKXCUPSWGFW-HNSCFVPZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Parafrankiaspecies CH37 (ncbitaxon:683308) | - | PubMed (33789052) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Frankobactin A2 (CHEBI:221196) is a cyclodepsipeptide (CHEBI:35213) |