EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N2O4 |
| Net Charge | 0 |
| Average Mass | 306.362 |
| Monoisotopic Mass | 306.15796 |
| SMILES | CN[C@@]1(CC(C)C)OC(=O)[C@@](O)(Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C16H22N2O4/c1-11(2)9-16(17-3)13(19)18-15(21,14(20)22-16)10-12-7-5-4-6-8-12/h4-8,11,17,21H,9-10H2,1-3H3,(H,18,19)/t15-,16-/m0/s1 |
| InChIKey | DPVKIQKSCWSCBE-HOTGVXAUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metarhizium (ncbitaxon:5529) | - | PubMed (1429244) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Metacytofilin (CHEBI:221191) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3S,6S)-3-benzyl-3-hydroxy-6-(methylamino)-6-(2-methylpropyl)morpholine-2,5-dione |
| Manual Xrefs | Databases |
|---|---|
| 62780217 | ChemSpider |