EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33N3O2 |
| Net Charge | 0 |
| Average Mass | 395.547 |
| Monoisotopic Mass | 395.25728 |
| SMILES | CN[C@H](C(=O)N(C)[C@@H](Cc1ccccc1)C(=O)NCCc1ccccc1)C(C)C |
| InChI | InChI=1S/C24H33N3O2/c1-18(2)22(25-3)24(29)27(4)21(17-20-13-9-6-10-14-20)23(28)26-16-15-19-11-7-5-8-12-19/h5-14,18,21-22,25H,15-17H2,1-4H3,(H,26,28)/t21-,22-/m0/s1 |
| InChIKey | MXXFZXJSHIUFOL-VXKWHMMOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus nematophila (ncbitaxon:628) | - | PubMed (21888371) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xenortide C (CHEBI:221177) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-N,3-dimethyl-2-(methylamino)-N-[(2S)-1-oxo-3-phenyl-1-(2-phenylethylamino)propan-2-yl]butanamide |
| Manual Xrefs | Databases |
|---|---|
| 58112412 | ChemSpider |