EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11ClN4O3 |
| Net Charge | 0 |
| Average Mass | 306.709 |
| Monoisotopic Mass | 306.05197 |
| SMILES | COC(=O)c1cc2c3c(c(N)c(Cl)c(N)c3n1)N(C)C2=O |
| InChI | InChI=1S/C13H11ClN4O3/c1-18-11-6-4(12(18)19)3-5(13(20)21-2)17-10(6)8(15)7(14)9(11)16/h3H,15-16H2,1-2H3 |
| InChIKey | DVCQUDXXTKJSPL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (33982054) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ammosester B (CHEBI:221160) is a aminoquinoline (CHEBI:36709) |
| IUPAC Name |
|---|
| methyl 9,11-diamino-10-chloro-2-methyl-3-oxo-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene-6-carboxylate |