EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30N4O8 |
| Net Charge | 0 |
| Average Mass | 466.491 |
| Monoisotopic Mass | 466.20636 |
| SMILES | CC[C@@]1(C)Oc2cc(ccc2O)[C@@H](O)[C@H](NC)C(=O)N[C@@H](C)C(=O)N[C@@H]1C(=O)NCC(=O)O |
| InChI | InChI=1S/C21H30N4O8/c1-5-21(3)17(20(32)23-9-14(27)28)25-18(30)10(2)24-19(31)15(22-4)16(29)11-6-7-12(26)13(8-11)33-21/h6-8,10,15-17,22,26,29H,5,9H2,1-4H3,(H,23,32)(H,24,31)(H,25,30)(H,27,28)/t10-,15-,16+,17+,21+/m0/s1 |
| InChIKey | XAJYTGHEDODUTC-KILRJQPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ustilaginoidea virens (ncbitaxon:1159556) | - | PubMed (9630863) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ustiloxin F (CHEBI:221106) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 2-[[(3R,4S,7S,10S,11R)-3-ethyl-11,15-dihydroxy-3,7-dimethyl-10-(methylamino)-6,9-dioxo-2-oxa-5,8-diazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene-4-carbonyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 8542712 | ChemSpider |