EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O6 |
| Net Charge | 0 |
| Average Mass | 346.379 |
| Monoisotopic Mass | 346.14164 |
| SMILES | C=C1OC(=O)C(=C(O)/C(C)=C/CC/C=C/C=C/[C@@H](C)CC(=O)O)C1=O |
| InChI | InChI=1S/C19H22O6/c1-12(11-15(20)21)9-7-5-4-6-8-10-13(2)17(22)16-18(23)14(3)25-19(16)24/h4-5,7,9-10,12,22H,3,6,8,11H2,1-2H3,(H,20,21)/b5-4+,9-7+,13-10+,17-16?/t12-/m1/s1 |
| InChIKey | UKXCJTSPCFNKCC-LDHQJDQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichoderma (ncbitaxon:5543) | - | PubMed (33570538) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trihazone F (CHEBI:221056) is a heterocyclic fatty acid (CHEBI:48847) |