EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H47ClN6O12 |
| Net Charge | 0 |
| Average Mass | 743.211 |
| Monoisotopic Mass | 742.29405 |
| SMILES | CC(C)C[C@@H](NC(=O)C(O)O)C(=O)N[C@@H](C(=O)N[C@H]1C(=O)N/C(=C/Cl)C(=O)N[C@@H](C(=O)O)Cc2cc(O)ccc2O[C@@H]1C(C)C)[C@@H](O)CCCN |
| InChI | InChI=1S/C32H47ClN6O12/c1-14(2)10-18(35-30(46)32(49)50)26(42)38-23(21(41)6-5-9-34)28(44)39-24-25(15(3)4)51-22-8-7-17(40)11-16(22)12-19(31(47)48)36-27(43)20(13-33)37-29(24)45/h7-8,11,13-15,18-19,21,23-25,32,40-41,49-50H,5-6,9-10,12,34H2,1-4H3,(H,35,46)(H,36,43)(H,37,45)(H,38,42)(H,39,44)(H,47,48)/b20-13+/t18-,19-,21+,23-,24-,25-/m1/s1 |
| InChIKey | JTQIWAWVJBFAKR-MMYSCLTRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bipolaris victoriae (ncbitaxon:40125) | - | DOI (10.1007/bf01946431) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Victoricine (CHEBI:221046) is a polypeptide (CHEBI:15841) |